C16H15FINO — CID 66101922
4-fluoro-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline (PubChem CID 66101922) has the molecular formula C16H15FINO and a molecular weight of 383.20 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline.
| Compound Name | 4-fluoro-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline |
|---|---|
| PubChem CID | 66101922 |
| Molecular Formula | C16H15FINO |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 4-fluoro-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline |
| SMILES | Nc1cc(I)c(F)cc1OC1CCCc2ccccc21 |
| InChI | InChI=1S/C16H15FINO/c17-12-8-16(14(19)9-13(12)18)20-15-7-3-5-10-4-1-2-6-11(10)15/h1-2,4,6,8-9,15H,3,5,7,19H2 |
| InChIKey | XZBPJWSFEMVTAH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|