C17H15FO2 — CID 43826149
3-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)benzaldehyde (PubChem CID 43826149) has the molecular formula C17H15FO2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 3-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)benzaldehyde.
| Compound Name | 3-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)benzaldehyde |
|---|---|
| PubChem CID | 43826149 |
| Molecular Formula | C17H15FO2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-fluoro-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)benzaldehyde |
| SMILES | O=Cc1ccc(OC2CCCc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C17H15FO2/c18-15-10-12(11-19)8-9-17(15)20-16-7-3-5-13-4-1-2-6-14(13)16/h1-2,4,6,8-11,16H,3,5,7H2 |
| InChIKey | IZUPGKZBJANJTN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|