C16H16FNO — CID 60790202
2-fluoro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline (PubChem CID 60790202) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-fluoro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline.
| Compound Name | 2-fluoro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline |
|---|---|
| PubChem CID | 60790202 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-fluoro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)aniline |
| SMILES | Nc1c(F)cccc1OC1CCCc2ccccc21 |
| InChI | InChI=1S/C16H16FNO/c17-13-8-4-10-15(16(13)18)19-14-9-3-6-11-5-1-2-7-12(11)14/h1-2,4-5,7-8,10,14H,3,6,9,18H2 |
| InChIKey | DUXYSEYOHNGITK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|