About 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine
5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine (PubChem CID 66924142) has the molecular formula C17H16N4O
and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine |
| PubChem CID | 66924142 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2c(O[C@H]3CCc4ccccc43)cccc2n1 |
| InChI | InChI=1S/C17H16N4O/c18-16-15-12(20-17(19)21-16)6-3-7-14(15)22-13-9-8-10-4-1-2-5-11(10)13/h1-7,13H,8-9H2,(H4,18,19,20,21)/t13-/m0/s1 |
| InChIKey | WHJAFSUXERPRKJ-ZDUSSCGKSA-N |
| XLogP | 2.86 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine?
The IUPAC name of 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine (CID 66924142) is 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine.
What is the SMILES notation for 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine?
The canonical SMILES for 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine is Nc1nc(N)c2c(O[C@H]3CCc4ccccc43)cccc2n1.
What is the InChIKey of 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine?
The InChIKey is WHJAFSUXERPRKJ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H16N4O/c18-16-15-12(20-17(19)21-16)6-3-7-14(15)22-13-9-8-10-4-1-2-5-11(10)13/h1-7,13H,8-9H2,(H4,18,19,20,21)/t13-/m0/s1.
What are the key properties of 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine?
5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine has a molecular weight of 292.34 g/mol, XLogP of 2.86, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]quinazoline-2,4-diamine is sourced from PubChem (CID 66924142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).