C16H16O — CID 57123599
1-(2-methylphenoxy)-2,3-dihydro-1H-indene (PubChem CID 57123599) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2-methylphenoxy)-2,3-dihydro-1H-indene.
| Compound Name | 1-(2-methylphenoxy)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 57123599 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(2-methylphenoxy)-2,3-dihydro-1H-indene |
| SMILES | Cc1ccccc1OC1CCc2ccccc21 |
| InChI | InChI=1S/C16H16O/c1-12-6-2-5-9-15(12)17-16-11-10-13-7-3-4-8-14(13)16/h2-9,16H,10-11H2,1H3 |
| InChIKey | QAVFFOCTDKGHLH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |