About ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate
ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate (PubChem CID 23136317) has the molecular formula C20H21FO3
and a molecular weight of 328.38 g/mol. Its IUPAC name is ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate |
| PubChem CID | 23136317 |
| Molecular Formula | C20H21FO3 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OC2CCc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C20H21FO3/c1-2-23-20(22)12-8-14-7-10-19(17(21)13-14)24-18-11-9-15-5-3-4-6-16(15)18/h3-7,10,13,18H,2,8-9,11-12H2,1H3 |
| InChIKey | MIBMLGQDCRLLRM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate?
The IUPAC name of ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate (CID 23136317) is ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate.
What is the SMILES notation for ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate?
The canonical SMILES for ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate is CCOC(=O)CCc1ccc(OC2CCc3ccccc32)c(F)c1.
What is the InChIKey of ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate?
The InChIKey is MIBMLGQDCRLLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FO3/c1-2-23-20(22)12-8-14-7-10-19(17(21)13-14)24-18-11-9-15-5-3-4-6-16(15)18/h3-7,10,13,18H,2,8-9,11-12H2,1H3.
What are the key properties of ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate?
ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate has a molecular weight of 328.38 g/mol, XLogP of 4.39, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(2,3-dihydro-1H-inden-1-yloxy)-3-fluorophenyl]propanoate is sourced from PubChem (CID 23136317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).