C13H19ClFNO3 — CID 164576661
ethyl 3-[4-(2-aminoethoxy)-3-fluorophenyl]propanoate;hydrochloride (PubChem CID 164576661) has the molecular formula C13H19ClFNO3 and a molecular weight of 291.75 g/mol. Its IUPAC name is ethyl 3-[4-(2-aminoethoxy)-3-fluorophenyl]propanoate;hydrochloride.
| Compound Name | ethyl 3-[4-(2-aminoethoxy)-3-fluorophenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 164576661 |
| Molecular Formula | C13H19ClFNO3 |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl 3-[4-(2-aminoethoxy)-3-fluorophenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCc1ccc(OCCN)c(F)c1.Cl |
| InChI | InChI=1S/C13H18FNO3.ClH/c1-2-17-13(16)6-4-10-3-5-12(11(14)9-10)18-8-7-15;/h3,5,9H,2,4,6-8,15H2,1H3;1H |
| InChIKey | XFANGNSUMHMBRR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |