C15H22O5 — CID 66907182
ethyl 3-[4-hydroxy-3-(3-methoxypropoxy)phenyl]propanoate (PubChem CID 66907182) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 3-[4-hydroxy-3-(3-methoxypropoxy)phenyl]propanoate.
| Compound Name | ethyl 3-[4-hydroxy-3-(3-methoxypropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 66907182 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | ethyl 3-[4-hydroxy-3-(3-methoxypropoxy)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(O)c(OCCCOC)c1 |
| InChI | InChI=1S/C15H22O5/c1-3-19-15(17)8-6-12-5-7-13(16)14(11-12)20-10-4-9-18-2/h5,7,11,16H,3-4,6,8-10H2,1-2H3 |
| InChIKey | DXQJMMSLNALVPB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|