C14H19BrO4 — CID 174513946
4-bromobutyl 3-(4-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 174513946) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-bromobutyl 3-(4-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | 4-bromobutyl 3-(4-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 174513946 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-bromobutyl 3-(4-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | COc1cc(CCC(=O)OCCCCBr)ccc1O |
| InChI | InChI=1S/C14H19BrO4/c1-18-13-10-11(4-6-12(13)16)5-7-14(17)19-9-3-2-8-15/h4,6,10,16H,2-3,5,7-9H2,1H3 |
| InChIKey | WXKGMYBTODAKCV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|