C10H11InO3 — CID 175936648
CID 175936648 (PubChem CID 175936648) has the molecular formula C10H11InO3 and a molecular weight of 294.01 g/mol.
| Compound Name | CID 175936648 |
|---|---|
| PubChem CID | 175936648 |
| Molecular Formula | C10H11InO3 |
| Molecular Weight | 294.01 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | — |
| SMILES | COc1cc(CCC(=O)[In])ccc1O |
| InChI | InChI=1S/C10H11O3.In/c1-13-10-7-8(3-2-6-11)4-5-9(10)12;/h4-5,7,12H,2-3H2,1H3; |
| InChIKey | VGTVQMMLDFQBIH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.01 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |