C21H24O5 — CID 91715816
(Z)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one (PubChem CID 91715816) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (Z)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one.
| Compound Name | (Z)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
|---|---|
| PubChem CID | 91715816 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (Z)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| SMILES | COc1cc(CC/C=C\C(=O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H24O5/c1-25-20-13-15(8-11-18(20)23)5-3-4-6-17(22)10-7-16-9-12-19(24)21(14-16)26-2/h4,6,8-9,11-14,23-24H,3,5,7,10H2,1-2H3/b6-4- |
| InChIKey | FWDXZNKYDTXGOT-XQRVVYSFSA-N |
| XLogP | 3.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|