C22H26O6 — CID 5318568
(E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one (PubChem CID 5318568) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one.
| Compound Name | (E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
|---|---|
| PubChem CID | 5318568 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| SMILES | COc1cc(CC/C=C/C(=O)CCc2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H26O6/c1-26-19-12-15(9-11-18(19)24)6-4-5-7-17(23)10-8-16-13-20(27-2)22(25)21(14-16)28-3/h5,7,9,11-14,24-25H,4,6,8,10H2,1-3H3/b7-5+ |
| InChIKey | GCCMDTDROAUVAS-FNORWQNLSA-N |
| XLogP | 3.81 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|