C27H35NO5 — CID 162839670
1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-[1-(methylaminomethyl)cyclopentyl]oxyphenyl]hept-4-en-3-one (PubChem CID 162839670) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-[1-(methylaminomethyl)cyclopentyl]oxyphenyl]hept-4-en-3-one.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-[1-(methylaminomethyl)cyclopentyl]oxyphenyl]hept-4-en-3-one |
|---|---|
| PubChem CID | 162839670 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-[1-(methylaminomethyl)cyclopentyl]oxyphenyl]hept-4-en-3-one |
| SMILES | CNCC1(Oc2cc(CCC=CC(=O)CCc3ccc(O)c(OC)c3)ccc2O)CCCC1 |
| InChI | InChI=1S/C27H35NO5/c1-28-19-27(15-5-6-16-27)33-26-18-20(10-14-24(26)31)7-3-4-8-22(29)12-9-21-11-13-23(30)25(17-21)32-2/h4,8,10-11,13-14,17-18,28,30-31H,3,5-7,9,12,15-16,19H2,1-2H3 |
| InChIKey | FGOJWYPKNHIIKC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|