C24H31NO6 — CID 162944674
7-[3-(ethylaminomethyl)-4-hydroxy-5-(hydroxymethoxy)phenyl]-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one (PubChem CID 162944674) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is 7-[3-(ethylaminomethyl)-4-hydroxy-5-(hydroxymethoxy)phenyl]-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one.
| Compound Name | 7-[3-(ethylaminomethyl)-4-hydroxy-5-(hydroxymethoxy)phenyl]-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
|---|---|
| PubChem CID | 162944674 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 7-[3-(ethylaminomethyl)-4-hydroxy-5-(hydroxymethoxy)phenyl]-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| SMILES | CCNCc1cc(CCC=CC(=O)CCc2ccc(O)c(OC)c2)cc(OCO)c1O |
| InChI | InChI=1S/C24H31NO6/c1-3-25-15-19-12-18(14-23(24(19)29)31-16-26)6-4-5-7-20(27)10-8-17-9-11-21(28)22(13-17)30-2/h5,7,9,11-14,25-26,28-29H,3-4,6,8,10,15-16H2,1-2H3 |
| InChIKey | NQAYEMIQTZMDKD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|