C20H23NO3 — CID 53357194
(E)-1-(3,4-dimethoxyphenyl)-7-pyridin-3-ylhept-4-en-3-one (PubChem CID 53357194) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-7-pyridin-3-ylhept-4-en-3-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-7-pyridin-3-ylhept-4-en-3-one |
|---|---|
| PubChem CID | 53357194 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-7-pyridin-3-ylhept-4-en-3-one |
| SMILES | COc1ccc(CCC(=O)/C=C/CCc2cccnc2)cc1OC |
| InChI | InChI=1S/C20H23NO3/c1-23-19-12-10-16(14-20(19)24-2)9-11-18(22)8-4-3-6-17-7-5-13-21-15-17/h4-5,7-8,10,12-15H,3,6,9,11H2,1-2H3/b8-4+ |
| InChIKey | FKNBPRLIXYDPEI-XBXARRHUSA-N |
| XLogP | 3.79 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|