C25H36O6 — CID 58685901
ethyl (E)-12-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]-10-oxododec-8-enoate (PubChem CID 58685901) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is ethyl (E)-12-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]-10-oxododec-8-enoate.
| Compound Name | ethyl (E)-12-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]-10-oxododec-8-enoate |
|---|---|
| PubChem CID | 58685901 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | ethyl (E)-12-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]-10-oxododec-8-enoate |
| SMILES | CCOC(=O)CCCCCC/C=C/C(=O)CCc1ccc(OC(=O)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C25H36O6/c1-5-30-24(27)13-11-9-7-6-8-10-12-21(26)16-14-20-15-17-22(23(18-20)29-4)31-25(28)19(2)3/h10,12,15,17-19H,5-9,11,13-14,16H2,1-4H3/b12-10+ |
| InChIKey | UOIDENBOAAPNCN-ZRDIBKRKSA-N |
| XLogP | 5.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|