C28H44O3 — CID 67822934
(2-methoxy-4-prop-2-enylphenyl) (Z)-octadec-9-enoate (PubChem CID 67822934) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (2-methoxy-4-prop-2-enylphenyl) (Z)-octadec-9-enoate.
| Compound Name | (2-methoxy-4-prop-2-enylphenyl) (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 67822934 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) (Z)-octadec-9-enoate |
| SMILES | C=CCc1ccc(OC(=O)CCCCCCC/C=C\CCCCCCCC)c(OC)c1 |
| InChI | InChI=1S/C28H44O3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-28(29)31-26-23-22-25(20-5-2)24-27(26)30-3/h5,12-13,22-24H,2,4,6-11,14-21H2,1,3H3/b13-12- |
| InChIKey | SSCUMJQOXROCNY-SEYXRHQNSA-N |
| XLogP | 8.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|