C52H84NO4+ — CID 11343580
[2-[(Z)-octadec-9-enoyl]oxy-4-[2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl]phenyl] (Z)-octadec-9-enoate (PubChem CID 11343580) has the molecular formula C52H84NO4+ and a molecular weight of 787.25 g/mol. Its IUPAC name is [2-[(Z)-octadec-9-enoyl]oxy-4-[2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl]phenyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[(Z)-octadec-9-enoyl]oxy-4-[2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl]phenyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 11343580 |
| Molecular Formula | C52H84NO4+ |
| Molecular Weight | 787.25 g/mol |
| Exact Mass | 786.64 |
| IUPAC Name | [2-[(Z)-octadec-9-enoyl]oxy-4-[2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethyl]phenyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc(CC[n+]2c(C)cc(C)cc2C)cc1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C52H84NO4/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-51(54)56-49-39-38-48(40-41-53-46(4)42-45(3)43-47(53)5)44-50(49)57-52(55)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,38-39,42-44H,6-19,24-37,40-41H2,1-5H3/q+1/b22-20-,23-21- |
| InChIKey | YOHKLQWODUUIIP-YEUCEMRASA-N |
| XLogP | 15.03 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.25 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|