C26H38O4 — CID 24858917
(4-formyl-2-methoxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 24858917) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | (4-formyl-2-methoxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 24858917 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | (4-formyl-2-methoxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C26H38O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-26(28)30-24-20-19-23(22-27)21-25(24)29-2/h7-8,10-11,19-22H,3-6,9,12-18H2,1-2H3/b8-7-,11-10- |
| InChIKey | ICLSCTGXDNHPKU-NQLNTKRDSA-N |
| XLogP | 7.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|