C43H66O5 — CID 123217724
(3-formyl-5-octadeca-9,12-dienoyloxyphenyl) octadeca-9,12-dienoate (PubChem CID 123217724) has the molecular formula C43H66O5 and a molecular weight of 663.00 g/mol. Its IUPAC name is (3-formyl-5-octadeca-9,12-dienoyloxyphenyl) octadeca-9,12-dienoate.
| Compound Name | (3-formyl-5-octadeca-9,12-dienoyloxyphenyl) octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 123217724 |
| Molecular Formula | C43H66O5 |
| Molecular Weight | 663.00 g/mol |
| Exact Mass | 662.49 |
| IUPAC Name | (3-formyl-5-octadeca-9,12-dienoyloxyphenyl) octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)Oc1cc(C=O)cc(OC(=O)CCCCCCCC=CCC=CCCCCC)c1 |
| InChI | InChI=1S/C43H66O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-42(45)47-40-35-39(38-44)36-41(37-40)48-43(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,35-38H,3-10,15-16,21-34H2,1-2H3 |
| InChIKey | HSZXZXSMBOESCU-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.00 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|