C68H108O6 — CID 173073065
[4-[2-[3,5-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]ethenyl]phenyl] (Z)-octadec-9-enoate (PubChem CID 173073065) has the molecular formula C68H108O6 and a molecular weight of 1021.61 g/mol. Its IUPAC name is [4-[2-[3,5-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]ethenyl]phenyl] (Z)-octadec-9-enoate.
| Compound Name | [4-[2-[3,5-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]ethenyl]phenyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 173073065 |
| Molecular Formula | C68H108O6 |
| Molecular Weight | 1021.61 g/mol |
| Exact Mass | 1020.81 |
| IUPAC Name | [4-[2-[3,5-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]ethenyl]phenyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc(C=Cc2cc(OC(=O)CCCCCCC/C=C\CCCCCCCC)cc(OC(=O)CCCCCCC/C=C\CCCCCCCC)c2)cc1 |
| InChI | InChI=1S/C68H108O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-66(69)72-63-56-54-61(55-57-63)52-53-62-58-64(73-67(70)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)60-65(59-62)74-68(71)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h25-30,52-60H,4-24,31-51H2,1-3H3/b28-25-,29-26-,30-27-,53-52? |
| InChIKey | BJNBNRCDRMCVCE-KFHCJNPASA-N |
| XLogP | 21.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.61 |
| LogP ≤ 5 | 21.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|