C34H42O4 — CID 68913486
[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] icosa-5,8,11,14-tetraenoate (PubChem CID 68913486) has the molecular formula C34H42O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is [4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] icosa-5,8,11,14-tetraenoate.
| Compound Name | [4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 68913486 |
| Molecular Formula | C34H42O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | [4-[2-(3,5-dihydroxyphenyl)ethenyl]phenyl] icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C34H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-34(37)38-33-24-22-29(23-25-33)20-21-30-26-31(35)28-32(36)27-30/h6-7,9-10,12-13,15-16,20-28,35-36H,2-5,8,11,14,17-19H2,1H3 |
| InChIKey | BUHUOTRJOVORQP-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|