C36H42O4 — CID 123762304
[3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 123762304) has the molecular formula C36H42O4 and a molecular weight of 538.73 g/mol. Its IUPAC name is [3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 123762304 |
| Molecular Formula | C36H42O4 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | [3-hydroxy-5-[2-(4-hydroxyphenyl)ethenyl]phenyl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)Oc1cc(O)cc(C=Cc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C36H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-36(39)40-35-29-32(28-34(38)30-35)23-22-31-24-26-33(37)27-25-31/h3-4,6-7,9-10,12-13,15-16,18-19,22-30,37-38H,2,5,8,11,14,17,20-21H2,1H3 |
| InChIKey | YCBZIYYGOGAWHG-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|