C22H20O8 — CID 159057426
4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid (PubChem CID 159057426) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is 4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 159057426 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]-4-oxobutanoic acid |
| SMILES | CC(=O)Oc1cc(/C=C/c2ccc(OC(=O)CCC(=O)O)cc2)cc(OC(C)=O)c1 |
| InChI | InChI=1S/C22H20O8/c1-14(23)28-19-11-17(12-20(13-19)29-15(2)24)4-3-16-5-7-18(8-6-16)30-22(27)10-9-21(25)26/h3-8,11-13H,9-10H2,1-2H3,(H,25,26)/b4-3+ |
| InChIKey | JYAKZSKPIIJTHI-ONEGZZNKSA-N |
| XLogP | 3.48 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|