C44H42O6 — CID 137357041
[4-[(E)-2-[3,5-bis(4-phenylbutanoyloxy)phenyl]ethenyl]phenyl] 4-phenylbutanoate (PubChem CID 137357041) has the molecular formula C44H42O6 and a molecular weight of 666.81 g/mol. Its IUPAC name is [4-[(E)-2-[3,5-bis(4-phenylbutanoyloxy)phenyl]ethenyl]phenyl] 4-phenylbutanoate.
| Compound Name | [4-[(E)-2-[3,5-bis(4-phenylbutanoyloxy)phenyl]ethenyl]phenyl] 4-phenylbutanoate |
|---|---|
| PubChem CID | 137357041 |
| Molecular Formula | C44H42O6 |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | [4-[(E)-2-[3,5-bis(4-phenylbutanoyloxy)phenyl]ethenyl]phenyl] 4-phenylbutanoate |
| SMILES | O=C(CCCc1ccccc1)Oc1ccc(/C=C/c2cc(OC(=O)CCCc3ccccc3)cc(OC(=O)CCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C44H42O6/c45-42(22-10-19-34-13-4-1-5-14-34)48-39-29-27-37(28-30-39)25-26-38-31-40(49-43(46)23-11-20-35-15-6-2-7-16-35)33-41(32-38)50-44(47)24-12-21-36-17-8-3-9-18-36/h1-9,13-18,25-33H,10-12,19-24H2/b26-25+ |
| InChIKey | QPMXXUHNHNJAOZ-OCEACIFDSA-N |
| XLogP | 9.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|