C34H42O10 — CID 154952489
[3-[(3R)-3-butanoyloxybutanoyl]oxy-5-[(E)-2-(4-butanoyloxyphenyl)ethenyl]phenyl] (3R)-3-butanoyloxybutanoate (PubChem CID 154952489) has the molecular formula C34H42O10 and a molecular weight of 610.70 g/mol. Its IUPAC name is [3-[(3R)-3-butanoyloxybutanoyl]oxy-5-[(E)-2-(4-butanoyloxyphenyl)ethenyl]phenyl] (3R)-3-butanoyloxybutanoate.
| Compound Name | [3-[(3R)-3-butanoyloxybutanoyl]oxy-5-[(E)-2-(4-butanoyloxyphenyl)ethenyl]phenyl] (3R)-3-butanoyloxybutanoate |
|---|---|
| PubChem CID | 154952489 |
| Molecular Formula | C34H42O10 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | [3-[(3R)-3-butanoyloxybutanoyl]oxy-5-[(E)-2-(4-butanoyloxyphenyl)ethenyl]phenyl] (3R)-3-butanoyloxybutanoate |
| SMILES | CCCC(=O)Oc1ccc(/C=C/c2cc(OC(=O)C[C@@H](C)OC(=O)CCC)cc(OC(=O)C[C@@H](C)OC(=O)CCC)c2)cc1 |
| InChI | InChI=1S/C34H42O10/c1-6-9-30(35)40-23(4)18-33(38)43-28-20-26(13-12-25-14-16-27(17-15-25)42-32(37)11-8-3)21-29(22-28)44-34(39)19-24(5)41-31(36)10-7-2/h12-17,20-24H,6-11,18-19H2,1-5H3/b13-12+/t23-,24-/m1/s1 |
| InChIKey | ZHGQLMXVUHONOL-ZRBKFCMDSA-N |
| XLogP | 6.62 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|