C44H66O6 — CID 175007631
2-[4-[(E)-2-[3,5-di(decanoyloxy)phenyl]ethenyl]phenyl]decanoic acid (PubChem CID 175007631) has the molecular formula C44H66O6 and a molecular weight of 691.01 g/mol. Its IUPAC name is 2-[4-[(E)-2-[3,5-di(decanoyloxy)phenyl]ethenyl]phenyl]decanoic acid.
| Compound Name | 2-[4-[(E)-2-[3,5-di(decanoyloxy)phenyl]ethenyl]phenyl]decanoic acid |
|---|---|
| PubChem CID | 175007631 |
| Molecular Formula | C44H66O6 |
| Molecular Weight | 691.01 g/mol |
| Exact Mass | 690.49 |
| IUPAC Name | 2-[4-[(E)-2-[3,5-di(decanoyloxy)phenyl]ethenyl]phenyl]decanoic acid |
| SMILES | CCCCCCCCCC(=O)Oc1cc(/C=C/c2ccc(C(CCCCCCCC)C(=O)O)cc2)cc(OC(=O)CCCCCCCCC)c1 |
| InChI | InChI=1S/C44H66O6/c1-4-7-10-13-16-19-22-25-42(45)49-39-33-37(34-40(35-39)50-43(46)26-23-20-17-14-11-8-5-2)28-27-36-29-31-38(32-30-36)41(44(47)48)24-21-18-15-12-9-6-3/h27-35,41H,4-26H2,1-3H3,(H,47,48)/b28-27+ |
| InChIKey | CIGJVBKHZCSUAM-BYYHNAKLSA-N |
| XLogP | 12.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.01 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|