C23H24O8 — CID 86305893
[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate (PubChem CID 86305893) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate.
| Compound Name | [4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 86305893 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
| SMILES | CC(=O)Oc1cc(/C=C/c2ccc(OC(=O)C(C)(CO)CO)cc2)cc(OC(C)=O)c1 |
| InChI | InChI=1S/C23H24O8/c1-15(26)29-20-10-18(11-21(12-20)30-16(2)27)5-4-17-6-8-19(9-7-17)31-22(28)23(3,13-24)14-25/h4-12,24-25H,13-14H2,1-3H3/b5-4+ |
| InChIKey | LWYPNIDRMFFKAK-SNAWJCMRSA-N |
| XLogP | 2.60 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|