C12H11F3O2 — CID 125476360
[4-[(E)-4,4,4-trifluorobut-1-enyl]phenyl] acetate (PubChem CID 125476360) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is [4-[(E)-4,4,4-trifluorobut-1-enyl]phenyl] acetate.
| Compound Name | [4-[(E)-4,4,4-trifluorobut-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 125476360 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | [4-[(E)-4,4,4-trifluorobut-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3O2/c1-9(16)17-11-6-4-10(5-7-11)3-2-8-12(13,14)15/h2-7H,8H2,1H3/b3-2+ |
| InChIKey | SPPZZXCKDYAMEB-NSCUHMNNSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|