C16H15F5O4 — CID 154318664
4,4,5,5,5-pentafluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate (PubChem CID 154318664) has the molecular formula C16H15F5O4 and a molecular weight of 366.28 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate.
| Compound Name | 4,4,5,5,5-pentafluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 154318664 |
| Molecular Formula | C16H15F5O4 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4,4,5,5,5-pentafluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)OCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F5O4/c1-11(22)25-13-6-3-12(4-7-13)5-8-14(23)24-10-2-9-15(17,18)16(19,20)21/h3-8H,2,9-10H2,1H3/b8-5+ |
| InChIKey | PNAXGWWOHKGKSI-VMPITWQZSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|