C28H31F5O6 — CID 154967249
[4-[(E)-3-(6-methoxyhexoxy)-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate (PubChem CID 154967249) has the molecular formula C28H31F5O6 and a molecular weight of 558.54 g/mol. Its IUPAC name is [4-[(E)-3-(6-methoxyhexoxy)-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate.
| Compound Name | [4-[(E)-3-(6-methoxyhexoxy)-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
|---|---|
| PubChem CID | 154967249 |
| Molecular Formula | C28H31F5O6 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | [4-[(E)-3-(6-methoxyhexoxy)-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
| SMILES | COCCCCCCOC(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H31F5O6/c1-36-18-4-2-3-5-19-38-25(34)16-9-21-7-12-24(13-8-21)39-26(35)22-10-14-23(15-11-22)37-20-6-17-27(29,30)28(31,32)33/h7-16H,2-6,17-20H2,1H3/b16-9+ |
| InChIKey | AUCANLPEGXWSSC-CXUHLZMHSA-N |
| XLogP | 7.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|