C24H23F5O6 — CID 142696072
[4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate (PubChem CID 142696072) has the molecular formula C24H23F5O6 and a molecular weight of 502.43 g/mol. Its IUPAC name is [4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate.
| Compound Name | [4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
|---|---|
| PubChem CID | 142696072 |
| Molecular Formula | C24H23F5O6 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | [4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]phenyl] 4-(4,4,5,5,5-pentafluoropentoxy)benzoate |
| SMILES | CCC(O)(O)C(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H23F5O6/c1-2-22(32,33)20(30)13-6-16-4-9-19(10-5-16)35-21(31)17-7-11-18(12-8-17)34-15-3-14-23(25,26)24(27,28)29/h4-13,32-33H,2-3,14-15H2,1H3/b13-6+ |
| InChIKey | FWJNNTKRBIZWRE-AWNIVKPZSA-N |
| XLogP | 4.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|