C24H21F7O5 — CID 130286891
[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,6,6,6-heptafluorohexoxy)benzoate (PubChem CID 130286891) has the molecular formula C24H21F7O5 and a molecular weight of 522.41 g/mol. Its IUPAC name is [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,6,6,6-heptafluorohexoxy)benzoate.
| Compound Name | [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,6,6,6-heptafluorohexoxy)benzoate |
|---|---|
| PubChem CID | 130286891 |
| Molecular Formula | C24H21F7O5 |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,5,5,6,6,6-heptafluorohexoxy)benzoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H21F7O5/c1-2-34-20(32)13-6-16-4-9-19(10-5-16)36-21(33)17-7-11-18(12-8-17)35-15-3-14-22(25,26)23(27,28)24(29,30)31/h4-13H,2-3,14-15H2,1H3/b13-6+ |
| InChIKey | KEEZNBGJDUAIQR-AWNIVKPZSA-N |
| XLogP | 6.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|