C34H33F5O7 — CID 153427765
6-[(E)-3-[4-[4-(2,2,3,3,3-pentafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyhexyl 3,5-dimethylbenzoate (PubChem CID 153427765) has the molecular formula C34H33F5O7 and a molecular weight of 648.62 g/mol. Its IUPAC name is 6-[(E)-3-[4-[4-(2,2,3,3,3-pentafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyhexyl 3,5-dimethylbenzoate.
| Compound Name | 6-[(E)-3-[4-[4-(2,2,3,3,3-pentafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyhexyl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 153427765 |
| Molecular Formula | C34H33F5O7 |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | 6-[(E)-3-[4-[4-(2,2,3,3,3-pentafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyhexyl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCCCCCCOC(=O)/C=C/c2ccc(OC(=O)c3ccc(OCC(F)(F)C(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C34H33F5O7/c1-23-19-24(2)21-27(20-23)31(41)44-18-6-4-3-5-17-43-30(40)16-9-25-7-12-29(13-8-25)46-32(42)26-10-14-28(15-11-26)45-22-33(35,36)34(37,38)39/h7-16,19-21H,3-6,17-18,22H2,1-2H3/b16-9+ |
| InChIKey | PQRLWPFTTDCHOH-CXUHLZMHSA-N |
| XLogP | 8.07 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|