C27H25F3N2O5 — CID 77222106
[4-[3-[3-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 77222106) has the molecular formula C27H25F3N2O5 and a molecular weight of 514.50 g/mol. Its IUPAC name is [4-[3-[3-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | [4-[3-[3-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 77222106 |
| Molecular Formula | C27H25F3N2O5 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [4-[3-[3-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | Nc1cc(N)cc(CCCOC(=O)C=Cc2ccc(OC(=O)c3ccc(OCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C27H25F3N2O5/c28-27(29,30)17-36-23-10-6-20(7-11-23)26(34)37-24-8-3-18(4-9-24)5-12-25(33)35-13-1-2-19-14-21(31)16-22(32)15-19/h3-12,14-16H,1-2,13,17,31-32H2 |
| InChIKey | STWKOKRBTPAEBT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|