C32H32F4N2O7 — CID 76720965
6-[3-[4-[4-(2,2,3,3-tetrafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate (PubChem CID 76720965) has the molecular formula C32H32F4N2O7 and a molecular weight of 632.61 g/mol. Its IUPAC name is 6-[3-[4-[4-(2,2,3,3-tetrafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate.
| Compound Name | 6-[3-[4-[4-(2,2,3,3-tetrafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 76720965 |
| Molecular Formula | C32H32F4N2O7 |
| Molecular Weight | 632.61 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | 6-[3-[4-[4-(2,2,3,3-tetrafluoropropoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCCOC(=O)C=Cc2ccc(OC(=O)c3ccc(OCC(F)(F)C(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C32H32F4N2O7/c33-31(34)32(35,36)20-44-26-12-8-22(9-13-26)30(41)45-27-10-5-21(6-11-27)7-14-28(39)42-15-3-1-2-4-16-43-29(40)23-17-24(37)19-25(38)18-23/h5-14,17-19,31H,1-4,15-16,20,37-38H2 |
| InChIKey | CQEKYCGXDRPKDQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|