C36H35F3N4O10 — CID 161223390
3,5-diaminobenzoic acid;2-[2-[3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]ethoxy]ethyl 3,5-diaminobenzoate (PubChem CID 161223390) has the molecular formula C36H35F3N4O10 and a molecular weight of 740.69 g/mol. Its IUPAC name is 3,5-diaminobenzoic acid;2-[2-[3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]ethoxy]ethyl 3,5-diaminobenzoate.
| Compound Name | 3,5-diaminobenzoic acid;2-[2-[3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]ethoxy]ethyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 161223390 |
| Molecular Formula | C36H35F3N4O10 |
| Molecular Weight | 740.69 g/mol |
| Exact Mass | 740.23 |
| IUPAC Name | 3,5-diaminobenzoic acid;2-[2-[3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]ethoxy]ethyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)O)c1.Nc1cc(N)cc(C(=O)OCCOCCOC(=O)C=Cc2ccc(OC(=O)c3ccc(OCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C29H27F3N2O8.C7H8N2O2/c30-29(31,32)18-41-24-8-4-20(5-9-24)28(37)42-25-6-1-19(2-7-25)3-10-26(35)39-13-11-38-12-14-40-27(36)21-15-22(33)17-23(34)16-21;8-5-1-4(7(10)11)2-6(9)3-5/h1-10,15-17H,11-14,18,33-34H2;1-3H,8-9H2,(H,10,11) |
| InChIKey | UXURPTNPBXYZMU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 238.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|