C20H17F3O6 — CID 142696066
[4-(trifluoromethoxy)phenyl] 4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]benzoate (PubChem CID 142696066) has the molecular formula C20H17F3O6 and a molecular weight of 410.34 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]benzoate |
|---|---|
| PubChem CID | 142696066 |
| Molecular Formula | C20H17F3O6 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]benzoate |
| SMILES | CCC(O)(O)C(=O)/C=C/c1ccc(C(=O)Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H17F3O6/c1-2-19(26,27)17(24)12-5-13-3-6-14(7-4-13)18(25)28-15-8-10-16(11-9-15)29-20(21,22)23/h3-12,26-27H,2H2,1H3/b12-5+ |
| InChIKey | OXFGVUPGGULZLG-LFYBBSHMSA-N |
| XLogP | 3.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|