C19H13F5O5 — CID 154967135
[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2,2-pentafluoroethoxy)benzoate (PubChem CID 154967135) has the molecular formula C19H13F5O5 and a molecular weight of 416.30 g/mol. Its IUPAC name is [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2,2-pentafluoroethoxy)benzoate.
| Compound Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2,2-pentafluoroethoxy)benzoate |
|---|---|
| PubChem CID | 154967135 |
| Molecular Formula | C19H13F5O5 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2,2-pentafluoroethoxy)benzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2ccc(OC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H13F5O5/c1-27-16(25)11-4-12-2-7-14(8-3-12)28-17(26)13-5-9-15(10-6-13)29-19(23,24)18(20,21)22/h2-11H,1H3/b11-4+ |
| InChIKey | GFSLZQRPMBRRFP-NYYWCZLTSA-N |
| XLogP | 4.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|