About [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate
[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate (PubChem CID 145350914) has the molecular formula C17H14O4S
and a molecular weight of 314.36 g/mol. Its IUPAC name is [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate.
Molecular Properties
| Compound Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate |
| PubChem CID | 145350914 |
| Molecular Formula | C17H14O4S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2ccc(S)cc2)cc1 |
| InChI | InChI=1S/C17H14O4S/c1-20-16(18)11-4-12-2-7-14(8-3-12)21-17(19)13-5-9-15(22)10-6-13/h2-11,22H,1H3/b11-4+ |
| InChIKey | UCWFPQQKEVZZAX-NYYWCZLTSA-N |
| XLogP | 3.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate?
The IUPAC name of [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate (CID 145350914) is [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate.
What is the SMILES notation for [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate?
The canonical SMILES for [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate is COC(=O)/C=C/c1ccc(OC(=O)c2ccc(S)cc2)cc1.
What is the InChIKey of [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate?
The InChIKey is UCWFPQQKEVZZAX-NYYWCZLTSA-N. The full InChI is InChI=1S/C17H14O4S/c1-20-16(18)11-4-12-2-7-14(8-3-12)21-17(19)13-5-9-15(22)10-6-13/h2-11,22H,1H3/b11-4+.
What are the key properties of [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate?
[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate has a molecular weight of 314.36 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate is sourced from PubChem (CID 145350914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).