C26H30O5 — CID 131993878
[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(3,4-dimethylcycloheptyl)oxybenzoate (PubChem CID 131993878) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(3,4-dimethylcycloheptyl)oxybenzoate.
| Compound Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(3,4-dimethylcycloheptyl)oxybenzoate |
|---|---|
| PubChem CID | 131993878 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(3,4-dimethylcycloheptyl)oxybenzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2ccc(OC3CCCC(C)C(C)C3)cc2)cc1 |
| InChI | InChI=1S/C26H30O5/c1-18-5-4-6-24(17-19(18)2)30-22-14-10-21(11-15-22)26(28)31-23-12-7-20(8-13-23)9-16-25(27)29-3/h7-16,18-19,24H,4-6,17H2,1-3H3/b16-9+ |
| InChIKey | BIRJLXHHAPMZAA-CXUHLZMHSA-N |
| XLogP | 5.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|