C33H24O6 — CID 45276598
[4-[(1E,6E)-7-(4-benzoyloxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate (PubChem CID 45276598) has the molecular formula C33H24O6 and a molecular weight of 516.55 g/mol. Its IUPAC name is [4-[(1E,6E)-7-(4-benzoyloxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate.
| Compound Name | [4-[(1E,6E)-7-(4-benzoyloxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate |
|---|---|
| PubChem CID | 45276598 |
| Molecular Formula | C33H24O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [4-[(1E,6E)-7-(4-benzoyloxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)c2ccccc2)cc1)CC(=O)/C=C/c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H24O6/c34-28(17-11-24-13-19-30(20-14-24)38-32(36)26-7-3-1-4-8-26)23-29(35)18-12-25-15-21-31(22-16-25)39-33(37)27-9-5-2-6-10-27/h1-22H,23H2/b17-11+,18-12+ |
| InChIKey | GPELDDFWTOTDLP-JYFOCSDGSA-N |
| XLogP | 6.38 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|