C64H44N2O8 — CID 54020846
[4-[2-[3,5,6-tris[2-(4-benzoyloxyphenyl)ethenyl]pyrazin-2-yl]ethenyl]phenyl] benzoate (PubChem CID 54020846) has the molecular formula C64H44N2O8 and a molecular weight of 969.06 g/mol. Its IUPAC name is [4-[2-[3,5,6-tris[2-(4-benzoyloxyphenyl)ethenyl]pyrazin-2-yl]ethenyl]phenyl] benzoate.
| Compound Name | [4-[2-[3,5,6-tris[2-(4-benzoyloxyphenyl)ethenyl]pyrazin-2-yl]ethenyl]phenyl] benzoate |
|---|---|
| PubChem CID | 54020846 |
| Molecular Formula | C64H44N2O8 |
| Molecular Weight | 969.06 g/mol |
| Exact Mass | 968.31 |
| IUPAC Name | [4-[2-[3,5,6-tris[2-(4-benzoyloxyphenyl)ethenyl]pyrazin-2-yl]ethenyl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(C=Cc2nc(C=Cc3ccc(OC(=O)c4ccccc4)cc3)c(C=Cc3ccc(OC(=O)c4ccccc4)cc3)nc2C=Cc2ccc(OC(=O)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C64H44N2O8/c67-61(49-13-5-1-6-14-49)71-53-33-21-45(22-34-53)29-41-57-58(42-30-46-23-35-54(36-24-46)72-62(68)50-15-7-2-8-16-50)66-60(44-32-48-27-39-56(40-28-48)74-64(70)52-19-11-4-12-20-52)59(65-57)43-31-47-25-37-55(38-26-47)73-63(69)51-17-9-3-10-18-51/h1-44H |
| InChIKey | KYUTWSRDNUOUOP-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.06 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|