C27H22O6 — CID 45276439
[4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate (PubChem CID 45276439) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate.
| Compound Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate |
|---|---|
| PubChem CID | 45276439 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]phenyl] benzoate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)c3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C27H22O6/c1-32-26-17-20(11-16-25(26)30)8-13-23(29)18-22(28)12-7-19-9-14-24(15-10-19)33-27(31)21-5-3-2-4-6-21/h2-17,30H,18H2,1H3/b12-7+,13-8+ |
| InChIKey | ZQWQYOZZHRYEPB-INOXDZRUSA-N |
| XLogP | 4.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|