C32H26O4 — CID 11454316
(E)-3-[4-[(Z)-1-(4-benzoyloxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 11454316) has the molecular formula C32H26O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-1-(4-benzoyloxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(Z)-1-(4-benzoyloxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11454316 |
| Molecular Formula | C32H26O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (E)-3-[4-[(Z)-1-(4-benzoyloxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(\c1ccc(/C=C/C(=O)O)cc1)c1ccc(OC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H26O4/c1-2-29(24-9-5-3-6-10-24)31(25-16-13-23(14-17-25)15-22-30(33)34)26-18-20-28(21-19-26)36-32(35)27-11-7-4-8-12-27/h3-22H,2H2,1H3,(H,33,34)/b22-15+,31-29- |
| InChIKey | MRSXABSWLPGUKI-XAGRJKKMSA-N |
| XLogP | 7.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|