C29H26NO2+ — CID 122212678
[4-[(E)-1,2-diphenylbut-1-enyl]phenyl] 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 122212678) has the molecular formula C29H26NO2+ and a molecular weight of 420.53 g/mol. Its IUPAC name is [4-[(E)-1,2-diphenylbut-1-enyl]phenyl] 1-methylpyridin-1-ium-3-carboxylate.
| Compound Name | [4-[(E)-1,2-diphenylbut-1-enyl]phenyl] 1-methylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 122212678 |
| Molecular Formula | C29H26NO2+ |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [4-[(E)-1,2-diphenylbut-1-enyl]phenyl] 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | CC/C(=C(/c1ccccc1)c1ccc(OC(=O)c2ccc[n+](C)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H26NO2/c1-3-27(22-11-6-4-7-12-22)28(23-13-8-5-9-14-23)24-16-18-26(19-17-24)32-29(31)25-15-10-20-30(2)21-25/h4-21H,3H2,1-2H3/q+1/b28-27+ |
| InChIKey | BHZPIVFVLJTBHW-BYYHNAKLSA-N |
| XLogP | 6.10 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|