C28H26O6 — CID 12787823
[4-[(Z)-1,2-bis(3-acetyloxyphenyl)but-1-enyl]phenyl] acetate (PubChem CID 12787823) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is [4-[(Z)-1,2-bis(3-acetyloxyphenyl)but-1-enyl]phenyl] acetate.
| Compound Name | [4-[(Z)-1,2-bis(3-acetyloxyphenyl)but-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 12787823 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [4-[(Z)-1,2-bis(3-acetyloxyphenyl)but-1-enyl]phenyl] acetate |
| SMILES | CC/C(=C(\c1ccc(OC(C)=O)cc1)c1cccc(OC(C)=O)c1)c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C28H26O6/c1-5-27(22-8-6-10-25(16-22)33-19(3)30)28(21-12-14-24(15-13-21)32-18(2)29)23-9-7-11-26(17-23)34-20(4)31/h6-17H,5H2,1-4H3/b28-27- |
| InChIKey | ROEGBJWLDUFUSF-DQSJHHFOSA-N |
| XLogP | 5.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|