C29H31NO5 — CID 67847001
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] acetate (PubChem CID 67847001) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] acetate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67847001 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] acetate |
| SMILES | CCC(=C(c1ccc(OCCN(C)C)cc1)c1ccc(OC(C)=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H31NO5/c1-5-26(23-10-15-27-28(18-23)34-19-33-27)29(22-8-13-25(14-9-22)35-20(2)31)21-6-11-24(12-7-21)32-17-16-30(3)4/h6-15,18H,5,16-17,19H2,1-4H3 |
| InChIKey | AZIQWVZPEAZZFH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|