C27H30NO6P — CID 67847034
[4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite (PubChem CID 67847034) has the molecular formula C27H30NO6P and a molecular weight of 495.51 g/mol. Its IUPAC name is [4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite.
| Compound Name | [4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 67847034 |
| Molecular Formula | C27H30NO6P |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite |
| SMILES | CC/C(=C(/c1ccc(OCCN(C)C)cc1)c1ccc(OP(O)O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H30NO6P/c1-4-24(21-9-14-25-26(17-21)33-18-32-25)27(20-7-12-23(13-8-20)34-35(29)30)19-5-10-22(11-6-19)31-16-15-28(2)3/h5-14,17,29-30H,4,15-16,18H2,1-3H3/b27-24+ |
| InChIKey | DBWZOZLUUZRGBA-SOYKGTTHSA-N |
| XLogP | 5.32 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|