C36H46N2O6 — CID 67846548
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[1,3-bis(dimethylamino)propan-2-yloxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 67846548) has the molecular formula C36H46N2O6 and a molecular weight of 602.77 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[1,3-bis(dimethylamino)propan-2-yloxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[1,3-bis(dimethylamino)propan-2-yloxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67846548 |
| Molecular Formula | C36H46N2O6 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[1,3-bis(dimethylamino)propan-2-yloxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCC(=C(c1ccc(OCOC(=O)C(C)(C)C)cc1)c1ccc(OC(CN(C)C)CN(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C36H46N2O6/c1-9-31(27-14-19-32-33(20-27)42-24-41-32)34(25-10-15-28(16-11-25)40-23-43-35(39)36(2,3)4)26-12-17-29(18-13-26)44-30(21-37(5)6)22-38(7)8/h10-20,30H,9,21-24H2,1-8H3 |
| InChIKey | FGIKEVXYHWXEGF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|